Compound Q&A

How is didecyl phthalate (CAS: 84-77-5) typically synthesized?

Answer

Didecyl phthalate
Didecyl phthalate (CAS: 84-77-5) is typically synthesized through the esterification of phthalic anhydride with decyl alcohol in the presence of a strong acid catalyst, such as concentrated sulfuric acid. The reaction yields a phthalate ester with a high selectivity and good yield. The process involves heating the reactants to around 80°C for several hours under stirring conditions.

About

CAS No 84-77-5
English Name Didecyl phthalate
Molecular Formula C28H46O4
Molecular Weight 446.67 g/mol
SMILES O=C(OCCCCCCCCCC)C1=CC=CC=C1C(OCCCCCCCCCC)=O
InChIKey PGIBJVOPLXHHGS-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Didecyl phthalate (CAS: 84-77-5)?

Didecyl phthalate (CAS: 84-77-5) is a colorless to light yellow liquid with a molecular weight of ap...

Compound Q&A

What industries use didecyl phthalate (CAS: 84-77-5)?

Didecyl phthalate (CAS: 84-77-5) is widely used in the polymers industry for plasticizers, in the ph...

Compound Q&A

What precautions should be taken when handling didecyl phthalate (CAS: 84-77-5)?

When handling didecyl phthalate (CAS: 84-77-5), it is essential to wear appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...