Compound Q&A

What industries use Ferrate(4-), hexakis(cyano-kC)-, tetrasodium, (OC-6-11) (CAS: 13601-19-9)?

Answer

Ferrate(4-), hexakis(cyano-kC)-, tetrasodium, (OC-6-11)-
Ferrate(4-), hexakis(cyano-kC)-, tetrasodium, (OC-6-11) (CAS: 13601-19-9) is primarily used in wastewater treatment and water purification processes due to its strong oxidizing properties. It also has applications in pharmaceuticals for the synthesis of certain compounds.

About

CAS No 13601-19-9
English Name Ferrate(4-), hexakis(cyano-kC)-, tetrasodium, (OC-6-11)-
Molecular Formula C6FeN6Na---
Molecular Weight 234.94 g/mol
SMILES N#[C-][Fe+2]([C-]#N)([C-]#N)([C-]#N)([C-]#N)[C-]#N.[Na+]
InChIKey OBOWFEZVRNRJBU-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ferrate(4-), hexakis(cyano-kC)-, tetrasodium, (OC-6-11) (CAS: 13601-19-9)?

Ferrate(4-), hexakis(cyano-kC)-, tetrasodium, (OC-6-11) (CAS: 13601-19-9) is a crystalline salt with...

Compound Q&A

How is Ferrate(4-), hexakis(cyano-kC)-, tetrasodium, (OC-6-11) (CAS: 13601-19-9) typically synthesized?

Ferrate(4-), hexakis(cyano-kC)-, tetrasodium, (OC-6-11) (CAS: 13601-19-9) is synthesized through a m...

Compound Q&A

What precautions should be taken when handling Ferrate(4-), hexakis(cyano-kC)-, tetrasodium, (OC-6-11) (CAS: 13601-19-9)?

When handling Ferrate(4-), hexakis(cyano-kC)-, tetrasodium, (OC-6-11) (CAS: 13601-19-9), use appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...