Compound Q&A

What are the physical and chemical properties of Ferrate(4-), hexakis(cyano-kC)-, tetrasodium, (OC-6-11) (CAS: 13601-19-9)?

Answer

Ferrate(4-), hexakis(cyano-kC)-, tetrasodium, (OC-6-11)-
Ferrate(4-), hexakis(cyano-kC)-, tetrasodium, (OC-6-11) (CAS: 13601-19-9) is a crystalline salt with a molecular weight of approximately 616.5 g/mol. It is slightly soluble in water. Chemically, it is highly reactive, particularly with reducing agents, and can act as an oxidizing agent.

About

CAS No 13601-19-9
English Name Ferrate(4-), hexakis(cyano-kC)-, tetrasodium, (OC-6-11)-
Molecular Formula C6FeN6Na---
Molecular Weight 234.94 g/mol
SMILES N#[C-][Fe+2]([C-]#N)([C-]#N)([C-]#N)([C-]#N)[C-]#N.[Na+]
InChIKey OBOWFEZVRNRJBU-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

How is Ferrate(4-), hexakis(cyano-kC)-, tetrasodium, (OC-6-11) (CAS: 13601-19-9) typically synthesized?

Ferrate(4-), hexakis(cyano-kC)-, tetrasodium, (OC-6-11) (CAS: 13601-19-9) is synthesized through a m...

Compound Q&A

What industries use Ferrate(4-), hexakis(cyano-kC)-, tetrasodium, (OC-6-11) (CAS: 13601-19-9)?

Ferrate(4-), hexakis(cyano-kC)-, tetrasodium, (OC-6-11) (CAS: 13601-19-9) is primarily used in waste...

Compound Q&A

What precautions should be taken when handling Ferrate(4-), hexakis(cyano-kC)-, tetrasodium, (OC-6-11) (CAS: 13601-19-9)?

When handling Ferrate(4-), hexakis(cyano-kC)-, tetrasodium, (OC-6-11) (CAS: 13601-19-9), use appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...