Compound Q&A

How is Ferrate(4-), hexakis(cyano-kC)-, tetrasodium, (OC-6-11) (CAS: 13601-19-9) typically synthesized?

Answer

Ferrate(4-), hexakis(cyano-kC)-, tetrasodium, (OC-6-11)-
Ferrate(4-), hexakis(cyano-kC)-, tetrasodium, (OC-6-11) (CAS: 13601-19-9) is synthesized through a multi-step process involving the reaction of ferric salts with sodium cyanide. The process typically includes careful control of pH and temperature to achieve the desired product yield and selectivity.

About

CAS No 13601-19-9
English Name Ferrate(4-), hexakis(cyano-kC)-, tetrasodium, (OC-6-11)-
Molecular Formula C6FeN6Na---
Molecular Weight 234.94 g/mol
SMILES N#[C-][Fe+2]([C-]#N)([C-]#N)([C-]#N)([C-]#N)[C-]#N.[Na+]
InChIKey OBOWFEZVRNRJBU-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ferrate(4-), hexakis(cyano-kC)-, tetrasodium, (OC-6-11) (CAS: 13601-19-9)?

Ferrate(4-), hexakis(cyano-kC)-, tetrasodium, (OC-6-11) (CAS: 13601-19-9) is a crystalline salt with...

Compound Q&A

What industries use Ferrate(4-), hexakis(cyano-kC)-, tetrasodium, (OC-6-11) (CAS: 13601-19-9)?

Ferrate(4-), hexakis(cyano-kC)-, tetrasodium, (OC-6-11) (CAS: 13601-19-9) is primarily used in waste...

Compound Q&A

What precautions should be taken when handling Ferrate(4-), hexakis(cyano-kC)-, tetrasodium, (OC-6-11) (CAS: 13601-19-9)?

When handling Ferrate(4-), hexakis(cyano-kC)-, tetrasodium, (OC-6-11) (CAS: 13601-19-9), use appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...