Compound Q&A

What industries use (H-Cys-OMe)2.2HCl (CAS: 32854-09-4)?

Answer

(H-Cys-OMe)2.2HCl
(H-Cys-OMe)2.2HCl is primarily used in the pharmaceutical industry for the synthesis of certain peptides and in the chemical industry for the production of additives and reagents. It is also used in the polymer industry as a monomer precursor and in the semiconductor industry for surface modification.

About

CAS No 32854-09-4
English Name (H-Cys-OMe)2.2HCl
Molecular Formula C8H18Cl2N2O4S2
Molecular Weight 341.28 g/mol
SMILES COC(=O)C(CSSCC(C(=O)OC)N)N.Cl.Cl
InChIKey QKWGUPFPCRKKMQ-BNTLRKBRSA-N
Last Updated: 2025-09-05 20:45

Related Q&A

Compound Q&A

What are the physical and chemical properties of (H-Cys-OMe)2.2HCl (CAS: 32854-09-4)?

(H-Cys-OMe)2.2HCl is a crystalline compound with a molecular weight of approximately 567.42 g/mol. I...

Compound Q&A

How is (H-Cys-OMe)2.2HCl (CAS: 32854-09-4) typically synthesized?

(H-Cys-OMe)2.2HCl is typically synthesized by the reaction of cysteine methyl ester hydrochloride (C...

Compound Q&A

What precautions should be taken when handling (H-Cys-OMe)2.2HCl (CAS: 32854-09-4)?

When handling (H-Cys-OMe)2.2HCl, ensure proper ventilation and use in a fume hood. Wear appropriate ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...