Compound Q&A

How is (H-Cys-OMe)2.2HCl (CAS: 32854-09-4) typically synthesized?

Answer

(H-Cys-OMe)2.2HCl
(H-Cys-OMe)2.2HCl is typically synthesized by the reaction of cysteine methyl ester hydrochloride (CME) with hydrogen cyanide in the presence of a catalyst such as potassium carbonate. The reaction is exothermic and requires careful temperature control to achieve high yield and selectivity.

About

CAS No 32854-09-4
English Name (H-Cys-OMe)2.2HCl
Molecular Formula C8H18Cl2N2O4S2
Molecular Weight 341.28 g/mol
SMILES COC(=O)C(CSSCC(C(=O)OC)N)N.Cl.Cl
InChIKey QKWGUPFPCRKKMQ-BNTLRKBRSA-N
Last Updated: 2025-09-05 20:45

Related Q&A

Compound Q&A

What are the physical and chemical properties of (H-Cys-OMe)2.2HCl (CAS: 32854-09-4)?

(H-Cys-OMe)2.2HCl is a crystalline compound with a molecular weight of approximately 567.42 g/mol. I...

Compound Q&A

What industries use (H-Cys-OMe)2.2HCl (CAS: 32854-09-4)?

(H-Cys-OMe)2.2HCl is primarily used in the pharmaceutical industry for the synthesis of certain pept...

Compound Q&A

What precautions should be taken when handling (H-Cys-OMe)2.2HCl (CAS: 32854-09-4)?

When handling (H-Cys-OMe)2.2HCl, ensure proper ventilation and use in a fume hood. Wear appropriate ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...