Compound Q&A

What are the physical and chemical properties of (H-Cys-OMe)2.2HCl (CAS: 32854-09-4)?

Answer

(H-Cys-OMe)2.2HCl
(H-Cys-OMe)2.2HCl is a crystalline compound with a molecular weight of approximately 567.42 g/mol. It is slightly soluble in water and has a pKa of 6.5. The compound is reactive towards strong bases and reducing agents. It is stable under normal storage conditions but should be protected from moisture and heat.

About

CAS No 32854-09-4
English Name (H-Cys-OMe)2.2HCl
Molecular Formula C8H18Cl2N2O4S2
Molecular Weight 341.28 g/mol
SMILES COC(=O)C(CSSCC(C(=O)OC)N)N.Cl.Cl
InChIKey QKWGUPFPCRKKMQ-BNTLRKBRSA-N
Last Updated: 2025-09-05 20:45

Related Q&A

Compound Q&A

How is (H-Cys-OMe)2.2HCl (CAS: 32854-09-4) typically synthesized?

(H-Cys-OMe)2.2HCl is typically synthesized by the reaction of cysteine methyl ester hydrochloride (C...

Compound Q&A

What industries use (H-Cys-OMe)2.2HCl (CAS: 32854-09-4)?

(H-Cys-OMe)2.2HCl is primarily used in the pharmaceutical industry for the synthesis of certain pept...

Compound Q&A

What precautions should be taken when handling (H-Cys-OMe)2.2HCl (CAS: 32854-09-4)?

When handling (H-Cys-OMe)2.2HCl, ensure proper ventilation and use in a fume hood. Wear appropriate ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...