Compound Q&A

What industries use D-Glucose, 6-O-a-D-galactopyranosyl- (CAS: 585-99-9)?

Answer

D-Glucose, 6-O-a-D-galactopyranosyl-
D-Glucose, 6-O-a-D-galactopyranosyl- (CAS: 585-99-9) is used in the pharmaceutical industry for the synthesis of glycoconjugates and in polymer chemistry for the preparation of biodegradable polymers. It is also applied in the development of biosensors and as a precursor in semiconductor manufacturing for creating functionalized surfaces.

About

CAS No 585-99-9
English Name D-Glucose, 6-O-a-D-galactopyranosyl-
Molecular Formula C12H24O12
Molecular Weight 360.31 g/mol
EINECS 209-568-6
SMILES OC[C@H]1O[C@H](OC[C@H]2O[C@@H](O)[C@@H]([C@H]([C@@H]2O)O)O)[C@@H]([C@H]([C@H]1O)O)O.O
InChIKey RGFAEJSLSYUKCO-OFGGXUQXSA-N
Last Updated: 2025-09-05 20:45

Related Q&A

Compound Q&A

What are the physical and chemical properties of D-Glucose, 6-O-a-D-galactopyranosyl- (CAS: 585-99-9)?

D-Glucose, 6-O-a-D-galactopyranosyl- (CAS: 585-99-9) is a cyclic sugar with a molecular weight of ap...

Compound Q&A

How is D-Glucose, 6-O-a-D-galactopyranosyl- (CAS: 585-99-9) typically synthesized?

D-Glucose, 6-O-a-D-galactopyranosyl- (CAS: 585-99-9) is typically synthesized through the condensati...

Compound Q&A

What precautions should be taken when handling D-Glucose, 6-O-a-D-galactopyranosyl- (CAS: 585-99-9)?

When handling D-Glucose, 6-O-a-D-galactopyranosyl- (CAS: 585-99-9), always wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...