Compound Q&A

What are the physical and chemical properties of D-Glucose, 6-O-a-D-galactopyranosyl- (CAS: 585-99-9)?

Answer

D-Glucose, 6-O-a-D-galactopyranosyl-
D-Glucose, 6-O-a-D-galactopyranosyl- (CAS: 585-99-9) is a cyclic sugar with a molecular weight of approximately 600 Da. It has a crystalline form and is highly soluble in water but less soluble in organic solvents. It exhibits moderate reactivity in nucleophilic substitution reactions and can form glycosidic bonds with other sugars.

About

CAS No 585-99-9
English Name D-Glucose, 6-O-a-D-galactopyranosyl-
Molecular Formula C12H24O12
Molecular Weight 360.31 g/mol
EINECS 209-568-6
SMILES OC[C@H]1O[C@H](OC[C@H]2O[C@@H](O)[C@@H]([C@H]([C@@H]2O)O)O)[C@@H]([C@H]([C@H]1O)O)O.O
InChIKey RGFAEJSLSYUKCO-OFGGXUQXSA-N
Last Updated: 2025-09-05 20:45

Related Q&A

Compound Q&A

How is D-Glucose, 6-O-a-D-galactopyranosyl- (CAS: 585-99-9) typically synthesized?

D-Glucose, 6-O-a-D-galactopyranosyl- (CAS: 585-99-9) is typically synthesized through the condensati...

Compound Q&A

What industries use D-Glucose, 6-O-a-D-galactopyranosyl- (CAS: 585-99-9)?

D-Glucose, 6-O-a-D-galactopyranosyl- (CAS: 585-99-9) is used in the pharmaceutical industry for the ...

Compound Q&A

What precautions should be taken when handling D-Glucose, 6-O-a-D-galactopyranosyl- (CAS: 585-99-9)?

When handling D-Glucose, 6-O-a-D-galactopyranosyl- (CAS: 585-99-9), always wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...