Compound Q&A

How is D-Glucose, 6-O-a-D-galactopyranosyl- (CAS: 585-99-9) typically synthesized?

Answer

D-Glucose, 6-O-a-D-galactopyranosyl-
D-Glucose, 6-O-a-D-galactopyranosyl- (CAS: 585-99-9) is typically synthesized through the condensation of D-galactose and D-glucose using a Lewis acid catalyst, such as aluminum bromide. The synthesis yields a mixture of isomers, with high selectivity towards the desired product. The reaction is carried out in an organic solvent with controlled temperature and pressure to ensure high yield.

About

CAS No 585-99-9
English Name D-Glucose, 6-O-a-D-galactopyranosyl-
Molecular Formula C12H24O12
Molecular Weight 360.31 g/mol
EINECS 209-568-6
SMILES OC[C@H]1O[C@H](OC[C@H]2O[C@@H](O)[C@@H]([C@H]([C@@H]2O)O)O)[C@@H]([C@H]([C@H]1O)O)O.O
InChIKey RGFAEJSLSYUKCO-OFGGXUQXSA-N
Last Updated: 2025-09-05 20:45

Related Q&A

Compound Q&A

What are the physical and chemical properties of D-Glucose, 6-O-a-D-galactopyranosyl- (CAS: 585-99-9)?

D-Glucose, 6-O-a-D-galactopyranosyl- (CAS: 585-99-9) is a cyclic sugar with a molecular weight of ap...

Compound Q&A

What industries use D-Glucose, 6-O-a-D-galactopyranosyl- (CAS: 585-99-9)?

D-Glucose, 6-O-a-D-galactopyranosyl- (CAS: 585-99-9) is used in the pharmaceutical industry for the ...

Compound Q&A

What precautions should be taken when handling D-Glucose, 6-O-a-D-galactopyranosyl- (CAS: 585-99-9)?

When handling D-Glucose, 6-O-a-D-galactopyranosyl- (CAS: 585-99-9), always wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...