Compound Q&A

What are the main uses of (3aR,4S,5R,6aS)-5-Hydroxy-4-(hydroxymethyl)hexahydro-2H-cyclopenta[b]furan-2-one (CAS: 32233-40-2)?

Answer

(3aR,4S,5R,6aS)-5-Hydroxy-4-(hydroxymethyl)hexahydro-2H-cyclopenta[b]furan-2-one
This compound serves as a key intermediate in pharmaceutical synthesis, particularly for developing drugs with specific stereochemical requirements. It is also utilized in industrial organic chemistry for creating complex molecules and in research for studying reaction mechanisms. Its applications may extend to food additives and specialty chemical manufacturing, depending on further derivatization.

About

CAS No 32233-40-2
English Name (3aR,4S,5R,6aS)-5-Hydroxy-4-(hydroxymethyl)hexahydro-2H-cyclopenta[b]furan-2-one
Molecular Formula C8H12O4
Molecular Weight 172.18 g/mol
SMILES O=C1C[C@@]([C@@H](CO)[C@H](O)C2)([H])[C@@]2([H])O1
InChIKey VYTZWRCSPHQSFX-GBNDHIKLSA-N
Last Updated: 2025-08-29 08:30

Related Q&A

Compound Q&A

What is (3aR,4S,5R,6aS)-5-Hydroxy-4-(hydroxymethyl)hexahydro-2H-cyclopenta[b]furan-2-one (CAS: 32233-40-2)?

This compound is a cyclic ether with a complex stereochemical structure, featuring hydroxyl groups a...

Compound Q&A

Is (3aR,4S,5R,6aS)-5-Hydroxy-4-(hydroxymethyl)hexahydro-2H-cyclopenta[b]furan-2-one (CAS: 32233-40-2) safe?

While generally considered safe in controlled environments, this compound requires proper handling t...

Compound Q&A

How should (3aR,4S,5R,6aS)-5-Hydroxy-4-(hydroxymethyl)hexahydro-2H-cyclopenta[b]furan-2-one (CAS: 32233-40-2) be stored?

This compound should be stored in a cool, dry place, away from light, in a sealed container to preve...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...