Compound Q&A

What is (3aR,4S,5R,6aS)-5-Hydroxy-4-(hydroxymethyl)hexahydro-2H-cyclopenta[b]furan-2-one (CAS: 32233-40-2)?

Answer

(3aR,4S,5R,6aS)-5-Hydroxy-4-(hydroxymethyl)hexahydro-2H-cyclopenta[b]furan-2-one
This compound is a cyclic ether with a complex stereochemical structure, featuring hydroxyl groups at positions 5 and 4. Its chemical formula is C7H12O3, and it exhibits polar characteristics due to the hydroxyl functionalities. It is commonly used as a synthetic intermediate in organic chemistry and pharmaceutical research, known for its stability under controlled conditions.

About

CAS No 32233-40-2
English Name (3aR,4S,5R,6aS)-5-Hydroxy-4-(hydroxymethyl)hexahydro-2H-cyclopenta[b]furan-2-one
Molecular Formula C8H12O4
Molecular Weight 172.18 g/mol
SMILES O=C1C[C@@]([C@@H](CO)[C@H](O)C2)([H])[C@@]2([H])O1
InChIKey VYTZWRCSPHQSFX-GBNDHIKLSA-N
Last Updated: 2025-08-29 08:30

Related Q&A

Compound Q&A

What are the main uses of (3aR,4S,5R,6aS)-5-Hydroxy-4-(hydroxymethyl)hexahydro-2H-cyclopenta[b]furan-2-one (CAS: 32233-40-2)?

This compound serves as a key intermediate in pharmaceutical synthesis, particularly for developing ...

Compound Q&A

Is (3aR,4S,5R,6aS)-5-Hydroxy-4-(hydroxymethyl)hexahydro-2H-cyclopenta[b]furan-2-one (CAS: 32233-40-2) safe?

While generally considered safe in controlled environments, this compound requires proper handling t...

Compound Q&A

How should (3aR,4S,5R,6aS)-5-Hydroxy-4-(hydroxymethyl)hexahydro-2H-cyclopenta[b]furan-2-one (CAS: 32233-40-2) be stored?

This compound should be stored in a cool, dry place, away from light, in a sealed container to preve...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...