Compound Q&A

How should [3,5-Bis(trifluoromethyl)phenyl]boronic acid (CAS: 73852-19-4) be stored?

Answer

[3,5-Bis(trifluoromethyl)phenyl]boronic acid
[3,5-Bis(trifluoromethyl)phenyl]boronic acid (CAS: 73852-19-4) should be stored in a dry, cool place (ideally 2-8°C) away from moisture and light. Keep it in a sealed, airtight container made of glass or HDPE to maintain stability and prevent degradation. Avoid exposure to incompatible substances and store in a well-ventilated area. Proper storage ensures its chemical integrity and extends shelf life for industrial and research applications.

About

CAS No 73852-19-4
English Name [3,5-Bis(trifluoromethyl)phenyl]boronic acid
Molecular Formula C8H5BF6O2
Molecular Weight 257.93 g/mol
SMILES B(C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)(O)O
InChIKey BPTABBGLHGBJQR-UHFFFAOYSA-N
Last Updated: 2025-08-29 08:30

Related Q&A

Compound Q&A

What is [3,5-Bis(trifluoromethyl)phenyl]boronic acid (CAS: 73852-19-4)?

[3,5-Bis(trifluoromethyl)phenyl]boronic acid (CAS: 73852-19-4) is a boronic acid derivative with a p...

Compound Q&A

What are the main uses of [3,5-Bis(trifluoromethyl)phenyl]boronic acid (CAS: 73852-19-4)?

[3,5-Bis(trifluoromethyl)phenyl]boronic acid (CAS: 73852-19-4) is primarily used in pharmaceuticals ...

Compound Q&A

Is [3,5-Bis(trifluoromethyl)phenyl]boronic acid (CAS: 73852-19-4) safe?

[3,5-Bis(trifluoromethyl)phenyl]boronic acid (CAS: 73852-19-4) is generally considered safe when han...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...