Compound Q&A

What is [3,5-Bis(trifluoromethyl)phenyl]boronic acid (CAS: 73852-19-4)?

Answer

[3,5-Bis(trifluoromethyl)phenyl]boronic acid
[3,5-Bis(trifluoromethyl)phenyl]boronic acid (CAS: 73852-19-4) is a boronic acid derivative with a phenyl ring substituted by two trifluoromethyl groups. Its chemical formula is C8H7BF3O2, and it appears as a white crystalline solid. The compound exhibits moderate solubility in organic solvents and is commonly used in organic synthesis due to its reactivity and functional group versatility. Its trifluoromethyl substituents enhance stability and provide unique chemical properties for applications in pharmaceutical and industrial chemistry.

About

CAS No 73852-19-4
English Name [3,5-Bis(trifluoromethyl)phenyl]boronic acid
Molecular Formula C8H5BF6O2
Molecular Weight 257.93 g/mol
SMILES B(C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)(O)O
InChIKey BPTABBGLHGBJQR-UHFFFAOYSA-N
Last Updated: 2025-08-29 08:30

Related Q&A

Compound Q&A

What are the main uses of [3,5-Bis(trifluoromethyl)phenyl]boronic acid (CAS: 73852-19-4)?

[3,5-Bis(trifluoromethyl)phenyl]boronic acid (CAS: 73852-19-4) is primarily used in pharmaceuticals ...

Compound Q&A

Is [3,5-Bis(trifluoromethyl)phenyl]boronic acid (CAS: 73852-19-4) safe?

[3,5-Bis(trifluoromethyl)phenyl]boronic acid (CAS: 73852-19-4) is generally considered safe when han...

Compound Q&A

How should [3,5-Bis(trifluoromethyl)phenyl]boronic acid (CAS: 73852-19-4) be stored?

[3,5-Bis(trifluoromethyl)phenyl]boronic acid (CAS: 73852-19-4) should be stored in a dry, cool place...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...