Compound Q&A

What are the main uses of [3,5-Bis(trifluoromethyl)phenyl]boronic acid (CAS: 73852-19-4)?

Answer

[3,5-Bis(trifluoromethyl)phenyl]boronic acid
[3,5-Bis(trifluoromethyl)phenyl]boronic acid (CAS: 73852-19-4) is primarily used in pharmaceuticals as a key intermediate in drug development, particularly for molecules requiring fluorinated functionality. It also serves in organic synthesis for Suzuki coupling reactions and other cross-coupling processes. Industrial applications include the production of specialty chemicals, while researchers utilize it in the creation of novel materials and functional compounds. Its unique structure makes it valuable in developing anti-cancer and anti-inflammatory agents.

About

CAS No 73852-19-4
English Name [3,5-Bis(trifluoromethyl)phenyl]boronic acid
Molecular Formula C8H5BF6O2
Molecular Weight 257.93 g/mol
SMILES B(C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)(O)O
InChIKey BPTABBGLHGBJQR-UHFFFAOYSA-N
Last Updated: 2025-08-29 08:30

Related Q&A

Compound Q&A

What is [3,5-Bis(trifluoromethyl)phenyl]boronic acid (CAS: 73852-19-4)?

[3,5-Bis(trifluoromethyl)phenyl]boronic acid (CAS: 73852-19-4) is a boronic acid derivative with a p...

Compound Q&A

Is [3,5-Bis(trifluoromethyl)phenyl]boronic acid (CAS: 73852-19-4) safe?

[3,5-Bis(trifluoromethyl)phenyl]boronic acid (CAS: 73852-19-4) is generally considered safe when han...

Compound Q&A

How should [3,5-Bis(trifluoromethyl)phenyl]boronic acid (CAS: 73852-19-4) be stored?

[3,5-Bis(trifluoromethyl)phenyl]boronic acid (CAS: 73852-19-4) should be stored in a dry, cool place...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...