Compound Q&A

Is (6R,7R)-7-Amino-3-{[(1-methyl-1H-tetrazol-5-yl)sulfanyl]methyl}-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (CAS: 24209-38-9) safe?

Answer

(6R,7R)-7-Amino-3-{[(1-methyl-1H-tetrazol-5-yl)sulfanyl]methyl}-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid
Safety data for this compound is limited, but as a chemical with complex functional groups, it requires standard laboratory precautions. Handling should involve protective gloves, goggles, and ventilation to minimize exposure. While no specific toxicity information is available, adherence to OSHA guidelines and proper storage are essential to ensure safe handling and reduce potential risks.

About

CAS No 24209-38-9
English Name (6R,7R)-7-Amino-3-{[(1-methyl-1H-tetrazol-5-yl)sulfanyl]methyl}-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid
Molecular Formula C10H12N6O3S2
Molecular Weight 328.38 g/mol
SMILES CN1C(=NN=N1)SCC2=C(N3C(C(C3=O)N)SC2)C(=O)O
InChIKey XUTQHTOXGKVJPN-SVGQVSJJSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is (6R,7R)-7-Amino-3-{[(1-methyl-1H-tetrazol-5-yl)sulfanyl]methyl}-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (CAS: 24209-38-9)?

This compound, with the CAS number 24209-38-9, is a complex organic molecule containing a bicyclic r...

Compound Q&A

What are the main uses of (6R,7R)-7-Amino-3-{[(1-methyl-1H-tetrazol-5-yl)sulfanyl]methyl}-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (CAS: 24209-38-9)?

This compound is primarily used in pharmaceutical research as a potential precursor for developing a...

Compound Q&A

How should (6R,7R)-7-Amino-3-{[(1-methyl-1H-tetrazol-5-yl)sulfanyl]methyl}-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (CAS: 24209-38-9) be stored?

This compound should be stored in a cool, dry place away from light, ideally at 2-8°C. It requires a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...