Compound Q&A

What is (6R,7R)-7-Amino-3-{[(1-methyl-1H-tetrazol-5-yl)sulfanyl]methyl}-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (CAS: 24209-38-9)?

Answer

(6R,7R)-7-Amino-3-{[(1-methyl-1H-tetrazol-5-yl)sulfanyl]methyl}-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid
This compound, with the CAS number 24209-38-9, is a complex organic molecule containing a bicyclic ring system, an amino group, a sulfanyl methyl group, and a carboxylic acid functional group. Its chemical formula is C10H14N6O3S2, and it exhibits structural features typical of thia-azabicyclic compounds, which are often studied for their biological activity and reactivity in chemical synthesis.

About

CAS No 24209-38-9
English Name (6R,7R)-7-Amino-3-{[(1-methyl-1H-tetrazol-5-yl)sulfanyl]methyl}-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid
Molecular Formula C10H12N6O3S2
Molecular Weight 328.38 g/mol
SMILES CN1C(=NN=N1)SCC2=C(N3C(C(C3=O)N)SC2)C(=O)O
InChIKey XUTQHTOXGKVJPN-SVGQVSJJSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of (6R,7R)-7-Amino-3-{[(1-methyl-1H-tetrazol-5-yl)sulfanyl]methyl}-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (CAS: 24209-38-9)?

This compound is primarily used in pharmaceutical research as a potential precursor for developing a...

Compound Q&A

Is (6R,7R)-7-Amino-3-{[(1-methyl-1H-tetrazol-5-yl)sulfanyl]methyl}-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (CAS: 24209-38-9) safe?

Safety data for this compound is limited, but as a chemical with complex functional groups, it requi...

Compound Q&A

How should (6R,7R)-7-Amino-3-{[(1-methyl-1H-tetrazol-5-yl)sulfanyl]methyl}-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (CAS: 24209-38-9) be stored?

This compound should be stored in a cool, dry place away from light, ideally at 2-8°C. It requires a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...