Compound Q&A

What are the main uses of (6R,7R)-7-Amino-3-{[(1-methyl-1H-tetrazol-5-yl)sulfanyl]methyl}-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (CAS: 24209-38-9)?

Answer

(6R,7R)-7-Amino-3-{[(1-methyl-1H-tetrazol-5-yl)sulfanyl]methyl}-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid
This compound is primarily used in pharmaceutical research as a potential precursor for developing antibiotics and antifungal agents. Its unique chemical structure makes it valuable in the synthesis of bioactive molecules, and it may also find applications in organic chemistry as a functional group-modifying agent. Specific industrial or food uses are not widely documented.

About

CAS No 24209-38-9
English Name (6R,7R)-7-Amino-3-{[(1-methyl-1H-tetrazol-5-yl)sulfanyl]methyl}-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid
Molecular Formula C10H12N6O3S2
Molecular Weight 328.38 g/mol
SMILES CN1C(=NN=N1)SCC2=C(N3C(C(C3=O)N)SC2)C(=O)O
InChIKey XUTQHTOXGKVJPN-SVGQVSJJSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is (6R,7R)-7-Amino-3-{[(1-methyl-1H-tetrazol-5-yl)sulfanyl]methyl}-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (CAS: 24209-38-9)?

This compound, with the CAS number 24209-38-9, is a complex organic molecule containing a bicyclic r...

Compound Q&A

Is (6R,7R)-7-Amino-3-{[(1-methyl-1H-tetrazol-5-yl)sulfanyl]methyl}-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (CAS: 24209-38-9) safe?

Safety data for this compound is limited, but as a chemical with complex functional groups, it requi...

Compound Q&A

How should (6R,7R)-7-Amino-3-{[(1-methyl-1H-tetrazol-5-yl)sulfanyl]methyl}-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (CAS: 24209-38-9) be stored?

This compound should be stored in a cool, dry place away from light, ideally at 2-8°C. It requires a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...