Compound Q&A

How should 1,2-benzoxazol-3-ylmethanesulfonic acid; sodium salt (CAS: 73101-64-1) be stored?

Answer

1,2-benzoxazol-3-ylmethanesulfonic acid;sodium salt
Store 1,2-benzoxazol-3-ylmethanesulfonic acid; sodium salt (CAS: 73101-64-1) in a cool, dry place, away from light and moisture. Keep it in a sealed container to maintain stability and prevent degradation. Avoid exposure to incompatible substances and ensure proper storage conditions to preserve its chemical integrity and safety.

About

CAS No 73101-64-1
English Name 1,2-benzoxazol-3-ylmethanesulfonic acid;sodium salt
Molecular Formula C8H6NNaO4S
Molecular Weight 235.19 g/mol
SMILES C1=CC=C2C(=C1)C(=NO2)CS(=O)(=O)[O-].[Na+]
InChIKey QILCHBOPDIODSB-UHFFFAOYSA-M
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is 1,2-benzoxazol-3-ylmethanesulfonic acid; sodium salt (CAS: 73101-64-1)?

1,2-Benzoxazol-3-ylmethanesulfonic acid; sodium salt (CAS: 73101-64-1) is a chemical compound with t...

Compound Q&A

What are the main uses of 1,2-benzoxazol-3-ylmethanesulfonic acid; sodium salt (CAS: 73101-64-1)?

This compound is primarily utilized in pharmaceuticals for drug development and as a key intermediat...

Compound Q&A

Is 1,2-benzoxazol-3-ylmethanesulfonic acid; sodium salt (CAS: 73101-64-1) safe?

While generally considered safe when handled properly, 1,2-benzoxazol-3-ylmethanesulfonic acid; sodi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...