Compound Q&A

What are the main uses of 1,2-benzoxazol-3-ylmethanesulfonic acid; sodium salt (CAS: 73101-64-1)?

Answer

1,2-benzoxazol-3-ylmethanesulfonic acid;sodium salt
This compound is primarily utilized in pharmaceuticals for drug development and as a key intermediate in the synthesis of bioactive molecules. It also finds applications in industrial processes, such as dye manufacturing, and in research for studying chemical reactivity. Its sulfonic acid group makes it valuable in creating compounds with specific binding or catalytic properties.

About

CAS No 73101-64-1
English Name 1,2-benzoxazol-3-ylmethanesulfonic acid;sodium salt
Molecular Formula C8H6NNaO4S
Molecular Weight 235.19 g/mol
SMILES C1=CC=C2C(=C1)C(=NO2)CS(=O)(=O)[O-].[Na+]
InChIKey QILCHBOPDIODSB-UHFFFAOYSA-M
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is 1,2-benzoxazol-3-ylmethanesulfonic acid; sodium salt (CAS: 73101-64-1)?

1,2-Benzoxazol-3-ylmethanesulfonic acid; sodium salt (CAS: 73101-64-1) is a chemical compound with t...

Compound Q&A

Is 1,2-benzoxazol-3-ylmethanesulfonic acid; sodium salt (CAS: 73101-64-1) safe?

While generally considered safe when handled properly, 1,2-benzoxazol-3-ylmethanesulfonic acid; sodi...

Compound Q&A

How should 1,2-benzoxazol-3-ylmethanesulfonic acid; sodium salt (CAS: 73101-64-1) be stored?

Store 1,2-benzoxazol-3-ylmethanesulfonic acid; sodium salt (CAS: 73101-64-1) in a cool, dry place, a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...