Compound Q&A

Is 1,2-benzoxazol-3-ylmethanesulfonic acid; sodium salt (CAS: 73101-64-1) safe?

Answer

1,2-benzoxazol-3-ylmethanesulfonic acid;sodium salt
While generally considered safe when handled properly, 1,2-benzoxazol-3-ylmethanesulfonic acid; sodium salt (CAS: 73101-64-1) may pose risks due to its potential to cause skin or eye irritation. Safety precautions include wearing protective gloves, goggles, and ensuring adequate ventilation. Always follow established safety protocols and consult chemical safety data sheets (SDS) for detailed information.

About

CAS No 73101-64-1
English Name 1,2-benzoxazol-3-ylmethanesulfonic acid;sodium salt
Molecular Formula C8H6NNaO4S
Molecular Weight 235.19 g/mol
SMILES C1=CC=C2C(=C1)C(=NO2)CS(=O)(=O)[O-].[Na+]
InChIKey QILCHBOPDIODSB-UHFFFAOYSA-M
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is 1,2-benzoxazol-3-ylmethanesulfonic acid; sodium salt (CAS: 73101-64-1)?

1,2-Benzoxazol-3-ylmethanesulfonic acid; sodium salt (CAS: 73101-64-1) is a chemical compound with t...

Compound Q&A

What are the main uses of 1,2-benzoxazol-3-ylmethanesulfonic acid; sodium salt (CAS: 73101-64-1)?

This compound is primarily utilized in pharmaceuticals for drug development and as a key intermediat...

Compound Q&A

How should 1,2-benzoxazol-3-ylmethanesulfonic acid; sodium salt (CAS: 73101-64-1) be stored?

Store 1,2-benzoxazol-3-ylmethanesulfonic acid; sodium salt (CAS: 73101-64-1) in a cool, dry place, a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...