Compound Q&A

How should 1-Benzofuran-6-carboxylic acid (CAS: 77095-51-3) be stored?

Answer

1-Benzofuran-6-carboxylic acid
1-Benzofuran-6-carboxylic acid (CAS: 77095-51-3) should be stored in a cool, dry place, away from light and moisture. Keep in a sealed, airtight container made of glass or HDPE to maintain stability. Avoid exposure to high temperatures or humidity to prevent degradation. Proper storage ensures its chemical integrity and safety for handling.

About

CAS No 77095-51-3
English Name 1-Benzofuran-6-carboxylic acid
Molecular Formula C9H6O3
Molecular Weight 162.14 g/mol
SMILES C1=CC(=CC2=C1C=CO2)C(=O)O
InChIKey RVDHGRQELZPGCO-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is 1-Benzofuran-6-carboxylic acid (CAS: 77095-51-3)?

1-Benzofuran-6-carboxylic acid (CAS: 77095-51-3) is an organic compound featuring a benzene ring fus...

Compound Q&A

What are the main uses of 1-Benzofuran-6-carboxylic acid (CAS: 77095-51-3)?

1-Benzofuran-6-carboxylic acid (CAS: 77095-51-3) is primarily used in pharmaceutical research as a b...

Compound Q&A

Is 1-Benzofuran-6-carboxylic acid (CAS: 77095-51-3) safe?

1-Benzofuran-6-carboxylic acid (CAS: 77095-51-3) is generally considered safe when handled properly,...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...