Compound Q&A

What are the main uses of 1-Benzofuran-6-carboxylic acid (CAS: 77095-51-3)?

Answer

1-Benzofuran-6-carboxylic acid
1-Benzofuran-6-carboxylic acid (CAS: 77095-51-3) is primarily used in pharmaceutical research as a building block for drug development, particularly in anti-inflammatory and antifungal agents. It also serves as an intermediate in the synthesis of specialty chemicals and natural products. Its unique structure makes it valuable in organic chemistry for creating derivatives with tailored properties.

About

CAS No 77095-51-3
English Name 1-Benzofuran-6-carboxylic acid
Molecular Formula C9H6O3
Molecular Weight 162.14399999999998 g/mol
SMILES C1=CC(=CC2=C1C=CO2)C(=O)O
InChIKey RVDHGRQELZPGCO-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is 1-Benzofuran-6-carboxylic acid (CAS: 77095-51-3)?

1-Benzofuran-6-carboxylic acid (CAS: 77095-51-3) is an organic compound featuring a benzene ring fus...

Compound Q&A

Is 1-Benzofuran-6-carboxylic acid (CAS: 77095-51-3) safe?

1-Benzofuran-6-carboxylic acid (CAS: 77095-51-3) is generally considered safe when handled properly,...

Compound Q&A

How should 1-Benzofuran-6-carboxylic acid (CAS: 77095-51-3) be stored?

1-Benzofuran-6-carboxylic acid (CAS: 77095-51-3) should be stored in a cool, dry place, away from li...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...