Compound Q&A

What is 1-Benzofuran-6-carboxylic acid (CAS: 77095-51-3)?

Answer

1-Benzofuran-6-carboxylic acid
1-Benzofuran-6-carboxylic acid (CAS: 77095-51-3) is an organic compound featuring a benzene ring fused with a furan ring and a carboxylic acid group at position 6. Its chemical formula is C9H6O3, and it exists as a white crystalline solid with moderate solubility in organic solvents. This compound is known for its aromatic structure and potential applications in various chemical fields.

About

CAS No 77095-51-3
English Name 1-Benzofuran-6-carboxylic acid
Molecular Formula C9H6O3
Molecular Weight 162.14399999999998 g/mol
SMILES C1=CC(=CC2=C1C=CO2)C(=O)O
InChIKey RVDHGRQELZPGCO-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of 1-Benzofuran-6-carboxylic acid (CAS: 77095-51-3)?

1-Benzofuran-6-carboxylic acid (CAS: 77095-51-3) is primarily used in pharmaceutical research as a b...

Compound Q&A

Is 1-Benzofuran-6-carboxylic acid (CAS: 77095-51-3) safe?

1-Benzofuran-6-carboxylic acid (CAS: 77095-51-3) is generally considered safe when handled properly,...

Compound Q&A

How should 1-Benzofuran-6-carboxylic acid (CAS: 77095-51-3) be stored?

1-Benzofuran-6-carboxylic acid (CAS: 77095-51-3) should be stored in a cool, dry place, away from li...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...