Compound Q&A

What are the main uses of L-Arginine - L-glutamic acid (1:1) (CAS: 4320-30-3)?

Answer

L-Arginine - L-glutamic acid (1:1)
L-Arginine - L-glutamic acid (1:1) is primarily used in pharmaceuticals for the development of amino acid-based drugs and as a component in nutritional supplements. In the food industry, it may be used as a flavor enhancer or amino acid additive. It is also employed in research for studying amino acid interactions, metabolic pathways, and as a model compound in biochemical studies. Its dual composition makes it valuable for applications requiring both arginine and glutamic acid functionalities.

About

CAS No 4320-30-3
English Name L-Arginine - L-glutamic acid (1:1)
Molecular Formula C11H23N5O6
Molecular Weight 321.33400000000006 g/mol
SMILES N[C@@H](CCCNC(=N)N)C(=O)O.N[C@@H](CCC(=O)O)C(=O)O
InChIKey RVEWUBJVAHOGKA-WOYAITHZSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is L-Arginine - L-glutamic acid (1:1) (CAS: 4320-30-3)?

L-Arginine - L-glutamic acid (1:1) is a compound composed of L-arginine and L-glutamic acid in a 1:1...

Compound Q&A

Is L-Arginine - L-glutamic acid (1:1) (CAS: 4320-30-3) safe?

L-Arginine - L-glutamic acid (1:1) is generally considered safe when used in appropriate amounts and...

Compound Q&A

How should L-Arginine - L-glutamic acid (1:1) (CAS: 4320-30-3) be stored?

L-Arginine - L-glutamic acid (1:1) should be stored in a cool, dry, and well-ventilatd place, away f...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...