Compound Q&A

What is L-Arginine - L-glutamic acid (1:1) (CAS: 4320-30-3)?

Answer

L-Arginine - L-glutamic acid (1:1)
L-Arginine - L-glutamic acid (1:1) is a compound composed of L-arginine and L-glutamic acid in a 1:1 molar ratio. It is commonly used in various scientific applications, including biochemistry and pharmaceutical research. The compound has a molecular formula of C10H17N4O6 and is typically a white to pale yellow crystalline solid with a slightly acidic pH. It is soluble in water and is known for its role in amino acid metabolism and physiological functions.

About

CAS No 4320-30-3
English Name L-Arginine - L-glutamic acid (1:1)
Molecular Formula C11H23N5O6
Molecular Weight 321.33 g/mol
SMILES N[C@@H](CCCNC(=N)N)C(=O)O.N[C@@H](CCC(=O)O)C(=O)O
InChIKey RVEWUBJVAHOGKA-WOYAITHZSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of L-Arginine - L-glutamic acid (1:1) (CAS: 4320-30-3)?

L-Arginine - L-glutamic acid (1:1) is primarily used in pharmaceuticals for the development of amino...

Compound Q&A

Is L-Arginine - L-glutamic acid (1:1) (CAS: 4320-30-3) safe?

L-Arginine - L-glutamic acid (1:1) is generally considered safe when used in appropriate amounts and...

Compound Q&A

How should L-Arginine - L-glutamic acid (1:1) (CAS: 4320-30-3) be stored?

L-Arginine - L-glutamic acid (1:1) should be stored in a cool, dry, and well-ventilatd place, away f...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...