Compound Q&A

Is Dibenzo[b,d]thiophen-4-ylboronic acid (CAS: 108847-20-7) safe?

Answer

Dibenzo[b,d]thiophen-4-ylboronic acid
Dibenzo[b,d]thiophen-4-ylboronic acid is generally considered safe when handled properly, but it may pose risks if exposed in high concentrations. Protective measures such as gloves, goggles, and a fume hood are recommended during handling. Safety data sheets (SDS) should be consulted for specific information on toxicity and exposure limits. Proper storage is essential to maintain its stability and ensure safe usage in laboratories and industrial settings.

About

English Name Dibenzo[b,d]thiophen-4-ylboronic acid
Molecular Formula C12H9BO2S
Molecular Weight 228.08 g/mol
SMILES B(C1=C2C(=CC=C1)C3=CC=CC=C3S2)(O)O
InChIKey GOXNHPQCCUVWRO-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is Dibenzo[b,d]thiophen-4-ylboronic acid (CAS: 108847-20-7)?

Dibenzo[b,d]thiophen-4-ylboronic acid is an organic compound with the CAS number 108847-20-7. It fea...

Compound Q&A

What are the main uses of Dibenzo[b,d]thiophen-4-ylboronic acid (CAS: 108847-20-7)?

Dibenzo[b,d]thiophen-4-ylboronic acid is primarily used in pharmaceutical research for drug developm...

Compound Q&A

How should Dibenzo[b,d]thiophen-4-ylboronic acid (CAS: 108847-20-7) be stored?

Dibenzo[b,d]thiophen-4-ylboronic acid should be stored in a cool, dry, and dark place to prevent deg...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...