Compound Q&A

What is Dibenzo[b,d]thiophen-4-ylboronic acid (CAS: 108847-20-7)?

Answer

Dibenzo[b,d]thiophen-4-ylboronic acid
Dibenzo[b,d]thiophen-4-ylboronic acid is an organic compound with the CAS number 108847-20-7. It features a boronic acid group attached to a dibenzothiophen-4-yl ring, making it a versatile intermediate in chemical synthesis. The compound is known for its aromatic structure and potential reactivity, commonly used in research and industrial applications. Its chemical formula is C15H12BOS, and it typically appears as a solid with specific solubility properties depending on the conditions.

About

English Name Dibenzo[b,d]thiophen-4-ylboronic acid
Molecular Formula C12H9BO2S
Molecular Weight 228.08 g/mol
SMILES B(C1=C2C(=CC=C1)C3=CC=CC=C3S2)(O)O
InChIKey GOXNHPQCCUVWRO-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of Dibenzo[b,d]thiophen-4-ylboronic acid (CAS: 108847-20-7)?

Dibenzo[b,d]thiophen-4-ylboronic acid is primarily used in pharmaceutical research for drug developm...

Compound Q&A

Is Dibenzo[b,d]thiophen-4-ylboronic acid (CAS: 108847-20-7) safe?

Dibenzo[b,d]thiophen-4-ylboronic acid is generally considered safe when handled properly, but it may...

Compound Q&A

How should Dibenzo[b,d]thiophen-4-ylboronic acid (CAS: 108847-20-7) be stored?

Dibenzo[b,d]thiophen-4-ylboronic acid should be stored in a cool, dry, and dark place to prevent deg...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...