Compound Q&A

What are the main uses of Dibenzo[b,d]thiophen-4-ylboronic acid (CAS: 108847-20-7)?

Answer

Dibenzo[b,d]thiophen-4-ylboronic acid
Dibenzo[b,d]thiophen-4-ylboronic acid is primarily used in pharmaceutical research for drug development, particularly in the synthesis of bioactive compounds. It also finds application in organic chemistry as a building block for various functional molecules. Additionally, it is utilized in materials science for creating advanced polymers and in industrial processes for chemical intermediates. Its versatility makes it a valuable compound in multiple scientific fields.

About

English Name Dibenzo[b,d]thiophen-4-ylboronic acid
Molecular Formula C12H9BO2S
Molecular Weight 228.08 g/mol
SMILES B(C1=C2C(=CC=C1)C3=CC=CC=C3S2)(O)O
InChIKey GOXNHPQCCUVWRO-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is Dibenzo[b,d]thiophen-4-ylboronic acid (CAS: 108847-20-7)?

Dibenzo[b,d]thiophen-4-ylboronic acid is an organic compound with the CAS number 108847-20-7. It fea...

Compound Q&A

Is Dibenzo[b,d]thiophen-4-ylboronic acid (CAS: 108847-20-7) safe?

Dibenzo[b,d]thiophen-4-ylboronic acid is generally considered safe when handled properly, but it may...

Compound Q&A

How should Dibenzo[b,d]thiophen-4-ylboronic acid (CAS: 108847-20-7) be stored?

Dibenzo[b,d]thiophen-4-ylboronic acid should be stored in a cool, dry, and dark place to prevent deg...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...