Compound Q&A

What are the main uses of Polyinosinic-polycytidylic acid (CAS: 24939-03-5)?

Answer

Polyinosinic-polycytidylic acid
Polyinosinic-polycytidylic acid (CAS: 24939-03-5) is primarily used in pharmaceutical research as an immunostimulant. It is also employed in vaccine development, gene therapy, and as a tool in molecular biology for studying RNA interference and immune responses. Additionally, it finds use in industrial and research settings for its unique biological properties.

About

CAS No 24939-03-5
English Name Polyinosinic-polycytidylic acid
Molecular Formula C19H27N7O16P2
Molecular Weight 671.4 g/mol
SMILES C1=CN(C(=O)N=C1N)C2C(C(C(O2)COP(=O)(O)O)O)O.C1=NC2=C(C(=O)N1)N=CN2C3C(C(C(O3)COP(=O)(O)O)O)O
InChIKey ACEVNMQDUCOKHT-ZLOOHWKQSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is Polyinosinic-polycytidylic acid (CAS: 24939-03-5)?

Polyinosinic-polycytidylic acid (Poly(I:C)), with the CAS number 24939-03-5, is a synthetic double-s...

Compound Q&A

Is Polyinosinic-polycytidylic acid (CAS: 24939-03-5) safe?

Polyinosinic-polycytidylic acid (CAS: 24939-03-5) is generally considered safe when used in controll...

Compound Q&A

How should Polyinosinic-polycytidylic acid (CAS: 24939-03-5) be stored?

Polyinosinic-polycytidylic acid (CAS: 24939-03-5) should be stored at controlled room temperature (1...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...