Compound Q&A

What is Polyinosinic-polycytidylic acid (CAS: 24939-03-5)?

Answer

Polyinosinic-polycytidylic acid
Polyinosinic-polycytidylic acid (Poly(I:C)), with the CAS number 24939-03-5, is a synthetic double-stranded RNA polymer. It is composed of repeating units of inosine and cytidine nucleotides and is known for its ability to mimic viral RNA. This compound is commonly used in research and has applications in immunology and biotechnology.

About

CAS No 24939-03-5
English Name Polyinosinic-polycytidylic acid
Molecular Formula C19H27N7O16P2
Molecular Weight 671.4 g/mol
SMILES C1=CN(C(=O)N=C1N)C2C(C(C(O2)COP(=O)(O)O)O)O.C1=NC2=C(C(=O)N1)N=CN2C3C(C(C(O3)COP(=O)(O)O)O)O
InChIKey ACEVNMQDUCOKHT-ZLOOHWKQSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of Polyinosinic-polycytidylic acid (CAS: 24939-03-5)?

Polyinosinic-polycytidylic acid (CAS: 24939-03-5) is primarily used in pharmaceutical research as an...

Compound Q&A

Is Polyinosinic-polycytidylic acid (CAS: 24939-03-5) safe?

Polyinosinic-polycytidylic acid (CAS: 24939-03-5) is generally considered safe when used in controll...

Compound Q&A

How should Polyinosinic-polycytidylic acid (CAS: 24939-03-5) be stored?

Polyinosinic-polycytidylic acid (CAS: 24939-03-5) should be stored at controlled room temperature (1...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...