Compound Q&A

What are the main uses of 3-[4-(2-Hydroxyethyl)-1-piperazinyl]-1-propanesulfonic acid (CAS: 16052-06-5)?

Answer

3-[4-(2-Hydroxyethyl)-1-piperazinyl]-1-propanesulfonic acid
3-[4-(2-Hydroxyethyl)-1-piperazinyl]-1-propanesulfonic acid (16052-06-5) is primarily used as a buffer in biochemical and pharmaceutical applications. It is also employed in molecular biology for maintaining pH during experiments such as DNA sequencing and protein analysis. Additionally, it finds use in the formulation of drugs and as a stabilizer in various industrial and research settings.

About

CAS No 16052-06-5
English Name 3-[4-(2-Hydroxyethyl)-1-piperazinyl]-1-propanesulfonic acid
Molecular Formula C9H20N2O4S
Molecular Weight 252.34 g/mol
SMILES C1CN(CCN1CCCS(=O)(=O)O)CCO
InChIKey OWXMKDGYPWMGEB-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is 3-[4-(2-Hydroxyethyl)-1-piperazinyl]-1-propanesulfonic acid (CAS: 16052-06-5)?

3-[4-(2-Hydroxyethyl)-1-piperazinyl]-1-propanesulfonic acid, with the CAS number 16052-06-5, is a zw...

Compound Q&A

Is 3-[4-(2-Hydroxyethyl)-1-piperazinyl]-1-propanesulfonic acid (CAS: 16052-06-5) safe?

3-[4-(2-Hydroxyethyl)-1-piperazinyl]-1-propanesulfonic acid (16052-06-5) is generally considered saf...

Compound Q&A

How should 3-[4-(2-Hydroxyethyl)-1-piperazinyl]-1-propanesulfonic acid (CAS: 16052-06-5) be stored?

3-[4-(2-Hydroxyethyl)-1-piperazinyl]-1-propanesulfonic acid (16052-06-5) should be stored in a cool,...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...