Compound Q&A

What is 3-[4-(2-Hydroxyethyl)-1-piperazinyl]-1-propanesulfonic acid (CAS: 16052-06-5)?

Answer

3-[4-(2-Hydroxyethyl)-1-piperazinyl]-1-propanesulfonic acid
3-[4-(2-Hydroxyethyl)-1-piperazinyl]-1-propanesulfonic acid, with the CAS number 16052-06-5, is a zwitterionic compound commonly used as a buffer in various scientific applications. It has a molecular formula of C8H18N2O5S and is known for its excellent solubility in water and pH stability. This compound is often used in biochemical and pharmaceutical research due to its buffering capacity and mild physiological compatibility.

About

CAS No 16052-06-5
English Name 3-[4-(2-Hydroxyethyl)-1-piperazinyl]-1-propanesulfonic acid
Molecular Formula C9H20N2O4S
Molecular Weight 252.34 g/mol
SMILES C1CN(CCN1CCCS(=O)(=O)O)CCO
InChIKey OWXMKDGYPWMGEB-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of 3-[4-(2-Hydroxyethyl)-1-piperazinyl]-1-propanesulfonic acid (CAS: 16052-06-5)?

3-[4-(2-Hydroxyethyl)-1-piperazinyl]-1-propanesulfonic acid (16052-06-5) is primarily used as a buff...

Compound Q&A

Is 3-[4-(2-Hydroxyethyl)-1-piperazinyl]-1-propanesulfonic acid (CAS: 16052-06-5) safe?

3-[4-(2-Hydroxyethyl)-1-piperazinyl]-1-propanesulfonic acid (16052-06-5) is generally considered saf...

Compound Q&A

How should 3-[4-(2-Hydroxyethyl)-1-piperazinyl]-1-propanesulfonic acid (CAS: 16052-06-5) be stored?

3-[4-(2-Hydroxyethyl)-1-piperazinyl]-1-propanesulfonic acid (16052-06-5) should be stored in a cool,...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...