Compound Q&A

Is Iron(2+) 2-acetyl-2,4-cyclopentadienide (CAS: 1271-55-2) safe?

Answer

Iron(2+) 2-acetyl-2,4-cyclopentadienide 2,4-cyclopentadienide (1:1:1)
Iron(2+) 2-acetyl-2,4-cyclopentadienide (CAS: 1271-55-2) is generally considered safe when handled properly. However, it can be toxic if inhaled, ingested, or comes into contact with skin or eyes. Protective measures such as gloves, goggles, and proper ventilation are recommended. Safety standards emphasize the need for controlled environments and adherence to chemical safety protocols during use and storage.

About

CAS No 1271-55-2
English Name Iron(2+) 2-acetyl-2,4-cyclopentadienide 2,4-cyclopentadienide (1:1:1)
Molecular Formula C12H12FeO
Molecular Weight 228.07 g/mol
EINECS 215-043-2
SMILES CC(=O)c1[cH-]ccc1.[cH-]1cccc1.[Fe+2]
InChIKey SPKJCVZOZISLEI-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is Iron(2+) 2-acetyl-2,4-cyclopentadienide (CAS: 1271-55-2)?

Iron(2+) 2-acetyl-2,4-cyclopentadienide (CAS: 1271-55-2) is a coordination compound containing an ir...

Compound Q&A

What are the main uses of Iron(2+) 2-acetyl-2,4-cyclopentadienide (CAS: 1271-55-2)?

Iron(2+) 2-acetyl-2,4-cyclopentadienide (CAS: 1271-55-2) is primarily used in catalytic applications...

Compound Q&A

How should Iron(2+) 2-acetyl-2,4-cyclopentadienide (CAS: 1271-55-2) be stored?

Iron(2+) 2-acetyl-2,4-cyclopentadienide (CAS: 1271-55-2) should be stored in a cool, dry, and dark p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...