Compound Q&A

What are the main uses of Iron(2+) 2-acetyl-2,4-cyclopentadienide (CAS: 1271-55-2)?

Answer

Iron(2+) 2-acetyl-2,4-cyclopentadienide 2,4-cyclopentadienide (1:1:1)
Iron(2+) 2-acetyl-2,4-cyclopentadienide (CAS: 1271-55-2) is primarily used in catalytic applications, particularly in organic synthesis and polymer chemistry. It also finds use in pharmaceutical research for developing new drugs and in materials science for creating advanced compounds. Its role as a metal complex makes it valuable in chemical reactions involving coordination and electron transfer mechanisms.

About

CAS No 1271-55-2
English Name Iron(2+) 2-acetyl-2,4-cyclopentadienide 2,4-cyclopentadienide (1:1:1)
Molecular Formula C12H12FeO
Molecular Weight 228.07 g/mol
EINECS 215-043-2
SMILES CC(=O)c1[cH-]ccc1.[cH-]1cccc1.[Fe+2]
InChIKey SPKJCVZOZISLEI-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is Iron(2+) 2-acetyl-2,4-cyclopentadienide (CAS: 1271-55-2)?

Iron(2+) 2-acetyl-2,4-cyclopentadienide (CAS: 1271-55-2) is a coordination compound containing an ir...

Compound Q&A

Is Iron(2+) 2-acetyl-2,4-cyclopentadienide (CAS: 1271-55-2) safe?

Iron(2+) 2-acetyl-2,4-cyclopentadienide (CAS: 1271-55-2) is generally considered safe when handled p...

Compound Q&A

How should Iron(2+) 2-acetyl-2,4-cyclopentadienide (CAS: 1271-55-2) be stored?

Iron(2+) 2-acetyl-2,4-cyclopentadienide (CAS: 1271-55-2) should be stored in a cool, dry, and dark p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...