Compound Q&A

What is Iron(2+) 2-acetyl-2,4-cyclopentadienide (CAS: 1271-55-2)?

Answer

Iron(2+) 2-acetyl-2,4-cyclopentadienide 2,4-cyclopentadienide (1:1:1)
Iron(2+) 2-acetyl-2,4-cyclopentadienide (CAS: 1271-55-2) is a coordination compound containing an iron ion in the +2 oxidation state bonded to a 2-acetyl-2,4-cyclopentadienide ligand. It is a complex organometallic compound with a molecular structure that includes a cyclopentadienyl ring substituted with an acetyl group. This compound is known for its unique chemical properties and reactivity in various chemical processes.

About

CAS No 1271-55-2
English Name Iron(2+) 2-acetyl-2,4-cyclopentadienide 2,4-cyclopentadienide (1:1:1)
Molecular Formula C12H12FeO
Molecular Weight 228.07 g/mol
EINECS 215-043-2
SMILES CC(=O)c1[cH-]ccc1.[cH-]1cccc1.[Fe+2]
InChIKey SPKJCVZOZISLEI-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of Iron(2+) 2-acetyl-2,4-cyclopentadienide (CAS: 1271-55-2)?

Iron(2+) 2-acetyl-2,4-cyclopentadienide (CAS: 1271-55-2) is primarily used in catalytic applications...

Compound Q&A

Is Iron(2+) 2-acetyl-2,4-cyclopentadienide (CAS: 1271-55-2) safe?

Iron(2+) 2-acetyl-2,4-cyclopentadienide (CAS: 1271-55-2) is generally considered safe when handled p...

Compound Q&A

How should Iron(2+) 2-acetyl-2,4-cyclopentadienide (CAS: 1271-55-2) be stored?

Iron(2+) 2-acetyl-2,4-cyclopentadienide (CAS: 1271-55-2) should be stored in a cool, dry, and dark p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...