Compound Q&A

How should 1-(1-Adamantyl)ethylamine HCl (CAS: 1501-84-4) be stored?

Answer

1-(1-Adamantyl)ethylamine HCl
1-(1-Adamantyl)ethylamine HCl (CAS: 1501-84-4) should be stored in a cool, dry, and well-ventilated area, away from moisture and direct light. It is typically kept in a sealed container to maintain stability and prevent degradation. Proper storage conditions are essential to ensure its chemical integrity and safety.

About

CAS No 1501-84-4
English Name 1-(1-Adamantyl)ethylamine HCl
Molecular Formula C12H22ClN
Molecular Weight 215.77 g/mol
SMILES CC(C12CC3CC(C1)CC(C3)C2)N.Cl
InChIKey OZBDFBJXRJWNAV-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is 1-(1-Adamantyl)ethylamine HCl (CAS: 1501-84-4)?

1-(1-Adamantyl)ethylamine HCl (CAS: 1501-84-4) is a hydrochloride salt of 1-(1-Adamantyl)ethylamine,...

Compound Q&A

What are the main uses of 1-(1-Adamantyl)ethylamine HCl (CAS: 1501-84-4)?

1-(1-Adamantyl)ethylamine HCl (CAS: 1501-84-4) is primarily used in pharmaceutical research as a bui...

Compound Q&A

Is 1-(1-Adamantyl)ethylamine HCl (CAS: 1501-84-4) safe?

1-(1-Adamantyl)ethylamine HCl (CAS: 1501-84-4) is generally considered safe when handled properly. H...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...