Compound Q&A

What are the main uses of 1-(1-Adamantyl)ethylamine HCl (CAS: 1501-84-4)?

Answer

1-(1-Adamantyl)ethylamine HCl
1-(1-Adamantyl)ethylamine HCl (CAS: 1501-84-4) is primarily used in pharmaceutical research as a building block for drug development. It also finds applications in organic synthesis, specialty chemicals, and as an intermediate in the production of various compounds. Its unique structure makes it valuable in creating molecules with specific biological activity.

About

CAS No 1501-84-4
English Name 1-(1-Adamantyl)ethylamine HCl
Molecular Formula C12H22ClN
Molecular Weight 215.77 g/mol
SMILES CC(C12CC3CC(C1)CC(C3)C2)N.Cl
InChIKey OZBDFBJXRJWNAV-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is 1-(1-Adamantyl)ethylamine HCl (CAS: 1501-84-4)?

1-(1-Adamantyl)ethylamine HCl (CAS: 1501-84-4) is a hydrochloride salt of 1-(1-Adamantyl)ethylamine,...

Compound Q&A

Is 1-(1-Adamantyl)ethylamine HCl (CAS: 1501-84-4) safe?

1-(1-Adamantyl)ethylamine HCl (CAS: 1501-84-4) is generally considered safe when handled properly. H...

Compound Q&A

How should 1-(1-Adamantyl)ethylamine HCl (CAS: 1501-84-4) be stored?

1-(1-Adamantyl)ethylamine HCl (CAS: 1501-84-4) should be stored in a cool, dry, and well-ventilated ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...