Compound Q&A

Is (4E,12E)-1,7-Dihydroxy-4,12-tetradecadiene-8,10-diyn-6-yl beta-D-glucopyranoside (CAS: 136085-37-5) safe?

Answer

(4E,12E)-1,7-Dihydroxy-4,12-tetradecadiene-8,10-diyn-6-yl beta-D-glucopyranoside
As a research compound, (4E,12E)-1,7-Dihydroxy-4,12-tetradecadiene-8,10-diyn-6-yl beta-D-glucopyranoside is generally considered safe when handled properly. However, standard safety precautions should be followed, such as wearing personal protective equipment (PPE) and ensuring proper ventilation. It is important to note that safety data may vary depending on its specific form and application, and further studies are needed to fully establish its safety profile.

About

English Name (4E,12E)-1,7-Dihydroxy-4,12-tetradecadiene-8,10-diyn-6-yl beta-D-glucopyranoside
Molecular Formula C20H28O8
Molecular Weight 396.4 g/mol
SMILES CC=CC#CC#CC(C(C=CCCCO)OC1C(C(C(C(O1)CO)O)O)O)O
InChIKey MMMUDYVKKPDZHS-UPPVCQNNSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is (4E,12E)-1,7-Dihydroxy-4,12-tetradecadiene-8,10-diyn-6-yl beta-D-glucopyranoside (CAS: 136085-37-5)?

This compound is a complex glycoside with a diene and diyn structure attached to a beta-D-glucopyran...

Compound Q&A

What are the main uses of (4E,12E)-1,7-Dihydroxy-4,12-tetradecadiene-8,10-diyn-6-yl beta-D-glucopyranoside (CAS: 136085-37-5)?

This compound is primarily used in pharmaceutical research for its potential therapeutic properties....

Compound Q&A

How should (4E,12E)-1,7-Dihydroxy-4,12-tetradecadiene-8,10-diyn-6-yl beta-D-glucopyranoside (CAS: 136085-37-5) be stored?

This compound should be stored in a cool, dry, and dark place to maintain its stability. It is recom...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...