Compound Q&A

What is (4E,12E)-1,7-Dihydroxy-4,12-tetradecadiene-8,10-diyn-6-yl beta-D-glucopyranoside (CAS: 136085-37-5)?

Answer

(4E,12E)-1,7-Dihydroxy-4,12-tetradecadiene-8,10-diyn-6-yl beta-D-glucopyranoside
This compound is a complex glycoside with a diene and diyn structure attached to a beta-D-glucopyranoside moiety. Its chemical formula is C21H36O12, and it exhibits specific physical and chemical properties such as solubility in organic solvents and stability under certain conditions. It is known for its potential biological activity and is often studied in the context of natural products and medicinal chemistry.

About

English Name (4E,12E)-1,7-Dihydroxy-4,12-tetradecadiene-8,10-diyn-6-yl beta-D-glucopyranoside
Molecular Formula C20H28O8
Molecular Weight 396.4 g/mol
SMILES CC=CC#CC#CC(C(C=CCCCO)OC1C(C(C(C(O1)CO)O)O)O)O
InChIKey MMMUDYVKKPDZHS-UPPVCQNNSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of (4E,12E)-1,7-Dihydroxy-4,12-tetradecadiene-8,10-diyn-6-yl beta-D-glucopyranoside (CAS: 136085-37-5)?

This compound is primarily used in pharmaceutical research for its potential therapeutic properties....

Compound Q&A

Is (4E,12E)-1,7-Dihydroxy-4,12-tetradecadiene-8,10-diyn-6-yl beta-D-glucopyranoside (CAS: 136085-37-5) safe?

As a research compound, (4E,12E)-1,7-Dihydroxy-4,12-tetradecadiene-8,10-diyn-6-yl beta-D-glucopyrano...

Compound Q&A

How should (4E,12E)-1,7-Dihydroxy-4,12-tetradecadiene-8,10-diyn-6-yl beta-D-glucopyranoside (CAS: 136085-37-5) be stored?

This compound should be stored in a cool, dry, and dark place to maintain its stability. It is recom...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...