Compound Q&A

What are the main uses of (4E,12E)-1,7-Dihydroxy-4,12-tetradecadiene-8,10-diyn-6-yl beta-D-glucopyranoside (CAS: 136085-37-5)?

Answer

(4E,12E)-1,7-Dihydroxy-4,12-tetradecadiene-8,10-diyn-6-yl beta-D-glucopyranoside
This compound is primarily used in pharmaceutical research for its potential therapeutic properties. It may also find applications in organic synthesis and as a bioactive molecule in drug development. Additionally, it is studied for its role in natural product chemistry and its possible use in medicinal applications, including anti-inflammatory or antimicrobial activities.

About

English Name (4E,12E)-1,7-Dihydroxy-4,12-tetradecadiene-8,10-diyn-6-yl beta-D-glucopyranoside
Molecular Formula C20H28O8
Molecular Weight 396.4 g/mol
SMILES CC=CC#CC#CC(C(C=CCCCO)OC1C(C(C(C(O1)CO)O)O)O)O
InChIKey MMMUDYVKKPDZHS-UPPVCQNNSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is (4E,12E)-1,7-Dihydroxy-4,12-tetradecadiene-8,10-diyn-6-yl beta-D-glucopyranoside (CAS: 136085-37-5)?

This compound is a complex glycoside with a diene and diyn structure attached to a beta-D-glucopyran...

Compound Q&A

Is (4E,12E)-1,7-Dihydroxy-4,12-tetradecadiene-8,10-diyn-6-yl beta-D-glucopyranoside (CAS: 136085-37-5) safe?

As a research compound, (4E,12E)-1,7-Dihydroxy-4,12-tetradecadiene-8,10-diyn-6-yl beta-D-glucopyrano...

Compound Q&A

How should (4E,12E)-1,7-Dihydroxy-4,12-tetradecadiene-8,10-diyn-6-yl beta-D-glucopyranoside (CAS: 136085-37-5) be stored?

This compound should be stored in a cool, dry, and dark place to maintain its stability. It is recom...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...