Compound Q&A

How should Jujuboside B (CAS: 55466-05-2) be stored?

Answer

Jujuboside B
Jujuboside B should be stored in a cool, dry, and dark place to maintain its stability and potency. It is recommended to keep it in a sealed, airtight container away from moisture and direct light. Proper storage conditions help preserve its chemical integrity and ensure safe handling over time.

About

CAS No 55466-05-2
English Name Jujuboside B
Molecular Formula C52H84O21
Molecular Weight 1045.2 g/mol
SMILES CC1C(C(C(C(O1)OC2C(C(COC2OC3CCC4(C5CCC6C7C(CC(OC78CC6(C5(CCC4C3(C)C)C)CO8)C=C(C)C)(C)O)C)O)OC9C(C(C(C(O9)CO)O)O)OC1C(C(C(CO1)O)O)O)O)O)O
InChIKey OAVAUZCEOWCYCC-QEOGCQCLSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is Jujuboside B (CAS: 55466-05-2)?

Jujuboside B is a natural compound derived from the fruit of the Chinese date (Ziziphus jujuba). It ...

Compound Q&A

What are the main uses of Jujuboside B (CAS: 55466-05-2)?

Jujuboside B is primarily used in pharmaceutical research for its antioxidant and anti-inflammatory ...

Compound Q&A

Is Jujuboside B (CAS: 55466-05-2) safe?

Jujuboside B is generally considered safe when used as directed, but proper handling is essential. I...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...