Compound Q&A

Is Jujuboside B (CAS: 55466-05-2) safe?

Answer

Jujuboside B
Jujuboside B is generally considered safe when used as directed, but proper handling is essential. It should be stored in a secure environment to prevent contamination. As with any natural compound, it is advisable to follow safety guidelines and consult healthcare professionals before use, especially in medicinal or therapeutic contexts.

About

CAS No 55466-05-2
English Name Jujuboside B
Molecular Formula C52H84O21
Molecular Weight 1045.2 g/mol
SMILES CC1C(C(C(C(O1)OC2C(C(COC2OC3CCC4(C5CCC6C7C(CC(OC78CC6(C5(CCC4C3(C)C)C)CO8)C=C(C)C)(C)O)C)O)OC9C(C(C(C(O9)CO)O)O)OC1C(C(C(CO1)O)O)O)O)O)O
InChIKey OAVAUZCEOWCYCC-QEOGCQCLSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is Jujuboside B (CAS: 55466-05-2)?

Jujuboside B is a natural compound derived from the fruit of the Chinese date (Ziziphus jujuba). It ...

Compound Q&A

What are the main uses of Jujuboside B (CAS: 55466-05-2)?

Jujuboside B is primarily used in pharmaceutical research for its antioxidant and anti-inflammatory ...

Compound Q&A

How should Jujuboside B (CAS: 55466-05-2) be stored?

Jujuboside B should be stored in a cool, dry, and dark place to maintain its stability and potency. ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...