Compound Q&A

What is Jujuboside B (CAS: 55466-05-2)?

Answer

Jujuboside B
Jujuboside B is a natural compound derived from the fruit of the Chinese date (Ziziphus jujuba). It has the chemical formula C16H26O10 and is known for its antioxidant and anti-inflammatory properties. This glycoside is commonly found in traditional herbal medicine and is studied for its potential therapeutic applications.

About

CAS No 55466-05-2
English Name Jujuboside B
Molecular Formula C52H84O21
Molecular Weight 1045.2 g/mol
SMILES CC1C(C(C(C(O1)OC2C(C(COC2OC3CCC4(C5CCC6C7C(CC(OC78CC6(C5(CCC4C3(C)C)C)CO8)C=C(C)C)(C)O)C)O)OC9C(C(C(C(O9)CO)O)O)OC1C(C(C(CO1)O)O)O)O)O)O
InChIKey OAVAUZCEOWCYCC-QEOGCQCLSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of Jujuboside B (CAS: 55466-05-2)?

Jujuboside B is primarily used in pharmaceutical research for its antioxidant and anti-inflammatory ...

Compound Q&A

Is Jujuboside B (CAS: 55466-05-2) safe?

Jujuboside B is generally considered safe when used as directed, but proper handling is essential. I...

Compound Q&A

How should Jujuboside B (CAS: 55466-05-2) be stored?

Jujuboside B should be stored in a cool, dry, and dark place to maintain its stability and potency. ...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...