Compound Q&A

What are the main uses of 4-(4-Amino-3-fluorophenoxy)-n-methylpicolinamide (CAS: 757251-39-1)?

Answer

4-(4-Amino-3-fluorophenoxy)-n-methylpicolinamide
4-(4-Amino-3-fluorophenoxy)-n-methylpicolinamide (CAS: 757251-39-1) is primarily used in pharmaceutical research as a potential lead compound for drug development. It may serve as an intermediate in the synthesis of various bioactive molecules. Additionally, it finds applications in chemical synthesis and can be relevant in studies related to medicinal chemistry and organic reactions.

About

English Name 4-(4-Amino-3-fluorophenoxy)-n-methylpicolinamide
Molecular Formula C13H12FN3O2
Molecular Weight 261.26 g/mol
SMILES CNC(=O)c1nccc(c1)Oc1ccc(c(c1)F)N
InChIKey ZQHJPIPGBODVTG-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is 4-(4-Amino-3-fluorophenoxy)-n-methylpicolinamide (CAS: 757251-39-1)?

4-(4-Amino-3-fluorophenoxy)-n-methylpicolinamide (CAS: 757251-39-1) is a chemical compound containin...

Compound Q&A

Is 4-(4-Amino-3-fluorophenoxy)-n-methylpicolinamide (CAS: 757251-39-1) safe?

The safety of 4-(4-Amino-3-fluorophenoxy)-n-methylpicolinamide (CAS: 757251-39-1) depends on its spe...

Compound Q&A

How should 4-(4-Amino-3-fluorophenoxy)-n-methylpicolinamide (CAS: 757251-39-1) be stored?

4-(4-Amino-3-fluorophenoxy)-n-methylpicolinamide (CAS: 757251-39-1) should be stored in a cool, dry,...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...