Compound Q&A

What is 4-(4-Amino-3-fluorophenoxy)-n-methylpicolinamide (CAS: 757251-39-1)?

Answer

4-(4-Amino-3-fluorophenoxy)-n-methylpicolinamide
4-(4-Amino-3-fluorophenoxy)-n-methylpicolinamide (CAS: 757251-39-1) is a chemical compound containing a picolinamide group linked to a 4-amino-3-fluorophenoxy moiety. It is characterized by its molecular structure, which includes an aromatic ring with fluorine and amino substituents, making it relevant in pharmaceutical and chemical research. The compound is known for its potential biological activity and is often studied for its applications in drug development.

About

English Name 4-(4-Amino-3-fluorophenoxy)-n-methylpicolinamide
Molecular Formula C13H12FN3O2
Molecular Weight 261.26 g/mol
SMILES CNC(=O)c1nccc(c1)Oc1ccc(c(c1)F)N
InChIKey ZQHJPIPGBODVTG-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of 4-(4-Amino-3-fluorophenoxy)-n-methylpicolinamide (CAS: 757251-39-1)?

4-(4-Amino-3-fluorophenoxy)-n-methylpicolinamide (CAS: 757251-39-1) is primarily used in pharmaceuti...

Compound Q&A

Is 4-(4-Amino-3-fluorophenoxy)-n-methylpicolinamide (CAS: 757251-39-1) safe?

The safety of 4-(4-Amino-3-fluorophenoxy)-n-methylpicolinamide (CAS: 757251-39-1) depends on its spe...

Compound Q&A

How should 4-(4-Amino-3-fluorophenoxy)-n-methylpicolinamide (CAS: 757251-39-1) be stored?

4-(4-Amino-3-fluorophenoxy)-n-methylpicolinamide (CAS: 757251-39-1) should be stored in a cool, dry,...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...