Compound Q&A

Is Sennoside B (CAS: 128-57-4) safe?

Answer

Sennoside B
Sennoside B is generally safe when used as directed, but excessive use may cause dehydration or electrolyte imbalances. It is considered low in toxicity for short-term use, though skin and eye irritation can occur during handling. Safety standards ensure it meets regulatory guidelines for pharmaceutical applications, including FDA approval for laxative use.

About

CAS No 128-57-4
English Name Sennoside B
Molecular Formula C42H38O20
Molecular Weight 862.74 g/mol
SMILES OC[C@H]1O[C@@H](Oc2cccc3c2C(=O)c2c([C@@H]3[C@@H]3c4cc(cc(c4C(=O)c4c3cccc4O[C@@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O)O)C(=O)O)cc(cc2O)C(=O)O)[C@@H]([C@H]([C@@H]1O)O)O
InChIKey IPQVTOJGNYVQEO-AIFLABODSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is Sennoside B (CAS: 128-57-4)?

Sennoside B is a natural anthraquinone glycoside derived from the Senna plant genus. Its chemical fo...

Compound Q&A

What are the main uses of Sennoside B (CAS: 128-57-4)?

Sennoside B (CAS 128-57-4) is primarily used as a laxative in over-the-counter medications for const...

Compound Q&A

How should Sennoside B (CAS: 128-57-4) be stored?

Sennoside B should be stored in a cool, dry place away from light to maintain stability. It is best ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...