Compound Q&A

What are the main uses of Sennoside B (CAS: 128-57-4)?

Answer

Sennoside B
Sennoside B (CAS 128-57-4) is primarily used as a laxative in over-the-counter medications for constipation relief. It also serves as a research compound in studies related to gastrointestinal motility and as a reference material in pharmaceutical development. Its natural origin makes it valuable in herbal medicine formulations.

About

CAS No 128-57-4
English Name Sennoside B
Molecular Formula C42H38O20
Molecular Weight 862.74 g/mol
SMILES OC[C@H]1O[C@@H](Oc2cccc3c2C(=O)c2c([C@@H]3[C@@H]3c4cc(cc(c4C(=O)c4c3cccc4O[C@@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O)O)C(=O)O)cc(cc2O)C(=O)O)[C@@H]([C@H]([C@@H]1O)O)O
InChIKey IPQVTOJGNYVQEO-AIFLABODSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is Sennoside B (CAS: 128-57-4)?

Sennoside B is a natural anthraquinone glycoside derived from the Senna plant genus. Its chemical fo...

Compound Q&A

Is Sennoside B (CAS: 128-57-4) safe?

Sennoside B is generally safe when used as directed, but excessive use may cause dehydration or elec...

Compound Q&A

How should Sennoside B (CAS: 128-57-4) be stored?

Sennoside B should be stored in a cool, dry place away from light to maintain stability. It is best ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...