Compound Q&A

Is Macranthoidin B (CAS: 136849-88-2) safe?

Answer

Macranthoidin B
Macranthoidin B is generally considered safe when handled properly, but it is important to follow standard safety protocols. As with many bioactive compounds, it should be used with caution in high concentrations, and protective measures such as gloves and goggles are recommended. Safety data is limited, so further research is needed to fully assess its long-term effects.

About

English Name Macranthoidin B
Molecular Formula C65H106O32
Molecular Weight 1399.5310000000015 g/mol
SMILES CC1OC(OC2C(O)C(O)COC2OC2CCC3(C)C(CCC4(C)C3CC=C3C5CC(C)(C)CCC5(CCC43C)C(=O)OC3OC(COC4OC(CO)C(O)C(O)C4O)C(O)C(O)C3O)C2(C)CO)C(O)C(OC2OC(CO)C(OC3OC(CO)C(O)C(O)C3O)C(O)C2O)C1O
InChIKey RKINZCVTEPSBCI-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What is Macranthoidin B (CAS: 136849-88-2)?

Macranthoidin B is a natural compound with the chemical formula C23H28O6. It is known for its bioact...

Compound Q&A

What are the main uses of Macranthoidin B (CAS: 136849-88-2)?

Macranthoidin B is primarily used in pharmaceutical research for its potential therapeutic applicati...

Compound Q&A

How should Macranthoidin B (CAS: 136849-88-2) be stored?

Macranthoidin B should be stored in a cool, dry, and dark place to maintain its stability. It is bes...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...