Compound Q&A

What is Macranthoidin B (CAS: 136849-88-2)?

Answer

Macranthoidin B is a natural compound with the chemical formula C23H28O6. It is known for its bioactive properties and is commonly found in certain plant species. This compound exhibits antioxidant and anti-inflammatory characteristics, making it a subject of interest in pharmaceutical and biological research.

About

CAS No 136849-88-2

English Name Macranthoidin B

Molecular Formula C65H106O32

Molecular Weight 1399.5310000000015 g/mol

SMILES CC1OC(OC2C(O)C(O)COC2OC2CCC3(C)C(CCC4(C)C3CC=C3C5CC(C)(C)CCC5(CCC43C)C(=O)OC3OC(COC4OC(CO)C(O)C(O)C4O)C(O)C(O)C3O)C2(C)CO)C(O)C(OC2OC(CO)C(OC3OC(CO)C(O)C(O)C3O)C(O)C2O)C1O

InChIKey RKINZCVTEPSBCI-UHFFFAOYSA-N

Last Updated: 2025-08-25 01:09

Related Q&A

Compound Q&A

What are the main uses of Macranthoidin B (CAS: 136849-88-2)?

Macranthoidin B is primarily used in pharmaceutical research for its potential therapeutic applicati...

Compound Q&A

Is Macranthoidin B (CAS: 136849-88-2) safe?

Macranthoidin B is generally considered safe when handled properly, but it is important to follow st...

Compound Q&A

How should Macranthoidin B (CAS: 136849-88-2) be stored?

Macranthoidin B should be stored in a cool, dry, and dark place to maintain its stability. It is bes...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...

Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...

Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...

Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...

What is Macranthoidin B (CAS: 136849-88-2)?

Answer

About

Related Q&A

What are the main uses of Macranthoidin B (CAS: 136849-88-2)?

Is Macranthoidin B (CAS: 136849-88-2) safe?

How should Macranthoidin B (CAS: 136849-88-2) be stored?

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Suppliers

Sichuan Jingcuibao Biotechnology Co., Ltd.

HuBeiXinKangYiYao Chemical Co Ltd

Chengdu LeMeiTian Medical Technology Co., Ltd.

ShangHaiJiNing Industrial Co Ltd

ShangHaiMaiKeLinShengHuaKeJi Inc

Shanghai Jieshukai Biotechnology Co., Ltd.